* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3,5-Triazine, 2-(1-azetidinyl)-4,6-dichloro- |
CAS: | 1864619-48-6 |
English Synonyms: | 1,3,5-TRIAZINE, 2-(1-AZETIDINYL)-4,6-DICHLORO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N1(CCC1)C1=NC(=NC(=N1)Cl)Cl |
InChi: | InChI=1S/C6H6Cl2N4/c7-4-9-5(8)11-6(10-4)12-2-1-3-12/h1-3H2 |
InChiKey: | InChIKey=WOMPAKPQMHVZJD-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.