* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,6-DibroMothieno[3,4-c]furan-1,3-dione |
CAS: | 1015423-45-6 |
English Synonyms: | 4,6-DIBROMOTHIENO[3,4-C]FURAN-1,3-DIONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC=1SC(=C2C(OC(C21)=O)=O)Br |
InChi: | InChI=1S/C6Br2O3S/c7-3-1-2(4(8)12-3)6(10)11-5(1)9 |
InChiKey: | InChIKey=OQMJQMGTDSIYNQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.