* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (4R,12aS)-7-Methoxy-4-methyl-6,8-dioxo-3,4,6,8,12,12a-hexahydro-2H-[1,3]oxazino[3,2-d]pyrido[1,2-a]pyrazine-9-carboxylic acid |
CAS: | 1335210-34-8 |
English Synonyms: | (4R,12AS)-7-METHOXY-4-METHYL-6,8-DIOXO-3,4,6,8,12,12A-HEXAHYDRO-2H-[1,3]OXAZINO[3,2-D]PYRIDO[1,2-A]PYRAZINE-9-CARBOXYLIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | COC=1C(C(=CN2C1C(N1[C@H](C2)OCC[C@H]1C)=O)C(=O)O)=O |
InChi: | InChI=1S/C14H16N2O6/c1-7-3-4-22-9-6-15-5-8(14(19)20)11(17)12(21-2)10(15)13(18)16(7)9/h5,7,9H,3-4,6H2,1-2H3,(H,19,20)/t7-,9+/m1/s1 |
InChiKey: | InChIKey=KGWJKKUSXSBPSK-APPZFPTMSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.