* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Benzene, 1-bromo-3-(cyclopentyloxy)- |
CAS: | 192870-98-7 |
English Synonyms: | BENZENE, 1-BROMO-3-(CYCLOPENTYLOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=CC(=CC=C1)OC1CCCC1 |
InChi: | InChI=1S/C11H13BrO/c12-9-4-3-7-11(8-9)13-10-5-1-2-6-10/h3-4,7-8,10H,1-2,5-6H2 |
InChiKey: | InChIKey=SQWHABAKTKOIIR-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.