* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzaldehyde, 4,4',4''-(1,3,5-triazine-2,4,6-triyl)tris- |
CAS: | 443922-06-3 |
English Synonyms: | BENZALDEHYDE, 4,4',4''-(1,3,5-TRIAZINE-2,4,6-TRIYL)TRIS- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N1=C(N=C(N=C1C1=CC=C(C=O)C=C1)C1=CC=C(C=O)C=C1)C1=CC=C(C=O)C=C1 |
InChi: | InChI=1S/C24H15N3O3/c28-13-16-1-7-19(8-2-16)22-25-23(20-9-3-17(14-29)4-10-20)27-24(26-22)21-11-5-18(15-30)6-12-21/h1-15H |
InChiKey: | InChIKey=RXFWPOMAJBVGRU-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.