* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-Chloro-[1,5]naphthyridin-4-ol |
CAS: | 1312760-59-0 |
English Synonyms: | 6-CHLORO-[1,5]NAPHTHYRIDIN-4-OL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC=1N=C2C(=CC=NC2=CC1)O |
InChi: | InChI=1S/C8H5ClN2O/c9-7-2-1-5-8(11-7)6(12)3-4-10-5/h1-4H,(H,10,12) |
InChiKey: | InChIKey=QKMKGIVCGORHJY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.