* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-Amino-N-(pyridin-3-yl)hexanamide HCl |
CAS: | 1016877-00-1 |
English Synonyms: | 6-AMINO-N-(PYRIDIN-3-YL)HEXANAMIDE HCL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cl.NCCCCCC(=O)NC=1C=NC=CC1 |
InChi: | InChI=1S/C11H17N3O.ClH/c12-7-3-1-2-6-11(15)14-10-5-4-8-13-9-10;/h4-5,8-9H,1-3,6-7,12H2,(H,14,15);1H |
InChiKey: | InChIKey=NWEMUZGQHCPAMK-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.