* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-bromo-4-methyl-6,7-dimethoxycoumarin |
CAS: | 100953-77-3 |
English Synonyms: | 3-BROMO-4-METHYL-6,7-DIMETHOXYCOUMARIN |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC=1C(OC2=CC(=C(C=C2C1C)OC)OC)=O |
InChi: | InChI=1S/C12H11BrO4/c1-6-7-4-9(15-2)10(16-3)5-8(7)17-12(14)11(6)13/h4-5H,1-3H3 |
InChiKey: | InChIKey=ZQLGHMWYNBGXES-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.