* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,8-Bis(chloromethyl)-1,2,3,5,6,7-hexahydro-s-indacene |
CAS: | 65935-63-9 |
English Synonyms: | 4,8-BIS(CHLOROMETHYL)-1,2,3,5,6,7-HEXAHYDRO-S-INDACENE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClCC1=C2CCCC2=C(C=2CCCC12)CCl |
InChi: | InChI=1S/C14H16Cl2/c15-7-13-9-3-1-4-10(9)14(8-16)12-6-2-5-11(12)13/h1-8H2 |
InChiKey: | InChIKey=YCFCIRSDZAMMMA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.