* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (2,6-dichloropyrimidin-4-yl)methanol |
CAS: | 321329-01-5 |
English Synonyms: | (2,6-DICHLOROPYRIMIDIN-4-YL)METHANOL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC1=NC(=CC(=N1)CO)Cl |
InChi: | InChI=1S/C5H4Cl2N2O/c6-4-1-3(2-10)8-5(7)9-4/h1,10H,2H2 |
InChiKey: | InChIKey=YSFXKEAJJBEXJI-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.