* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-Nitroindazole |
CAS: | 2942-40-7 |
English Synonyms: | 4-NITROINDAZOLE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | [N+](=O)([O-])C1=C2C=NNC2=CC=C1 |
InChi: | InChI=1S/C7H5N3O2/c11-10(12)7-3-1-2-6-5(7)4-8-9-6/h1-4H,(H,8,9) |
InChiKey: | InChIKey=WBTVZVUYPVQEIF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.