* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7H-12-Oxa-7-aza-indeno[1,2-a]fluorene |
CAS: | 1246308-85-9 |
English Synonyms: | 7H-12-OXA-7-AZA-INDENO[1,2-A]FLUORENE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1=CC=CC=2C=3C=CC4=C(C3OC12)C1=CC=CC=C1N4 |
InChi: | InChI=1S/C18H11NO/c1-3-7-14-13(6-1)17-15(19-14)10-9-12-11-5-2-4-8-16(11)20-18(12)17/h1-10,19H |
InChiKey: | InChIKey=XYZGAMBQUKTSIJ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.