* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,9-Dimethyl-10-[4-(4,4,5,5-tetramethyl-[1,3,2]dioxaborolan-2-yl)-phenyl]-9,10-dihydro-acridine |
CAS: | 1643935-09-4 |
English Synonyms: | 9,9-DIMETHYL-10-[4-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-PHENYL]-9,10-DIHYDRO-ACRIDINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1(C2=CC=CC=C2N(C=2C=CC=CC12)C1=CC=C(C=C1)B1OC(C(O1)(C)C)(C)C)C |
InChi: | InChI=1S/C27H30BNO2/c1-25(2)21-11-7-9-13-23(21)29(24-14-10-8-12-22(24)25)20-17-15-19(16-18-20)28-30-26(3,4)27(5,6)31-28/h7-18H,1-6H3 |
InChiKey: | InChIKey=ITBBSQIVFBCCRG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.