* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-methoxy-3,4-dihydro-(1H)-quinazoline-2-thione |
CAS: | 736985-41-4 |
English Synonyms: | 6-METHOXY-3,4-DIHYDRO-(1H)-QUINAZOLINE-2-THIONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | COC=1C=C2CNC(NC2=CC1)=S |
InChi: | InChI=1S/C9H10N2OS/c1-12-7-2-3-8-6(4-7)5-10-9(13)11-8/h2-4H,5H2,1H3,(H2,10,11,13) |
InChiKey: | InChIKey=LHCGUXVKOLHUTJ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.