* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Heptanoic acid, 2-amino-7-hydroxy- |
CAS: | 2171657-73-9 |
English Synonyms: | HEPTANOIC ACID, 2-AMINO-7-HYDROXY- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NC(C(=O)O)CCCCCO |
InChi: | InChI=1S/C7H15NO3/c8-6(7(10)11)4-2-1-3-5-9/h6,9H,1-5,8H2,(H,10,11) |
InChiKey: | InChIKey=HNNFYWQGCVWFSF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.