* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzonitrile, 3-[(6-hydroxyhexyl)oxy]- |
CAS: | 1695884-10-6 |
English Synonyms: | BENZONITRILE, 3-[(6-HYDROXYHEXYL)OXY]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | OCCCCCCOC=1C=C(C#N)C=CC1 |
InChi: | InChI=1S/C13H17NO2/c14-11-12-6-5-7-13(10-12)16-9-4-2-1-3-8-15/h5-7,10,15H,1-4,8-9H2 |
InChiKey: | InChIKey=QKSPXBZSWSIBFU-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.