* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Hexanamine, 6-(4-ethoxyphenoxy)- |
CAS: | 1407286-41-2 |
English Synonyms: | 1-HEXANAMINE, 6-(4-ETHOXYPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)OC1=CC=C(OCCCCCCN)C=C1 |
InChi: | InChI=1S/C14H23NO2/c1-2-16-13-7-9-14(10-8-13)17-12-6-4-3-5-11-15/h7-10H,2-6,11-12,15H2,1H3 |
InChiKey: | InChIKey=XYVZUTJKCTYUCX-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.