* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Pentanamine, 5-(4-ethylphenoxy)- |
CAS: | 1225687-24-0 |
English Synonyms: | 1-PENTANAMINE, 5-(4-ETHYLPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)C1=CC=C(OCCCCCN)C=C1 |
InChi: | InChI=1S/C13H21NO/c1-2-12-6-8-13(9-7-12)15-11-5-3-4-10-14/h6-9H,2-5,10-11,14H2,1H3 |
InChiKey: | InChIKey=YWJWZLHLDCGEQN-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.