* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Heptanol, 7-amino- |
CAS: | 1039627-31-0 |
English Synonyms: | 2-HEPTANOL, 7-AMINO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NCCCCCC(C)O |
InChi: | InChI=1S/C7H17NO/c1-7(9)5-3-2-4-6-8/h7,9H,2-6,8H2,1H3 |
InChiKey: | InChIKey=ASKPDICTKJJHPJ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.