* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-Isoindole-1,3(2H)-dione, 2-(2,6-dioxo-3-piperidinyl)-5-fluoro- |
CAS: | 835616-61-0 |
English Synonyms: | 1H-ISOINDOLE-1,3(2H)-DIONE, 2-(2,6-DIOXO-3-PIPERIDINYL)-5-FLUORO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | O=C1NC(CCC1N1C(C2=CC=C(C=C2C1=O)F)=O)=O |
InChi: | InChI=1S/C13H9FN2O4/c14-6-1-2-7-8(5-6)13(20)16(12(7)19)9-3-4-10(17)15-11(9)18/h1-2,5,9H,3-4H2,(H,15,17,18) |
InChiKey: | InChIKey=MPQLCQKBYRSPNA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.