* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-Indole-1-acetic acid, 7-methoxy- |
CAS: | 1547001-42-2 |
English Synonyms: | 1H-INDOLE-1-ACETIC ACID, 7-METHOXY- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | COC=1C=CC=C2C=CN(C12)CC(=O)O |
InChi: | InChI=1S/C11H11NO3/c1-15-9-4-2-3-8-5-6-12(11(8)9)7-10(13)14/h2-6H,7H2,1H3,(H,13,14) |
InChiKey: | InChIKey=QRFGXMBYWBGVSY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.