* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | D-Tyrosine, 2,6-dimethoxy-O-methyl- |
CAS: | 1388851-47-5 |
English Synonyms: | D-TYROSINE, 2,6-DIMETHOXY-O-METHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | COC1=C(C[C@@H](N)C(=O)O)C(=CC(=C1)OC)OC |
InChi: | InChI=1S/C12H17NO5/c1-16-7-4-10(17-2)8(11(5-7)18-3)6-9(13)12(14)15/h4-5,9H,6,13H2,1-3H3,(H,14,15)/t9-/m1/s1 |
InChiKey: | InChIKey=QESYXNOPUZJHKA-SECBINFHSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.