* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | D-Cysteine, S-propyl- |
CAS: | 85955-34-6 |
English Synonyms: | D-CYSTEINE, S-PROPYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(CC)SC[C@@H](N)C(=O)O |
InChi: | InChI=1S/C6H13NO2S/c1-2-3-10-4-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 |
InChiKey: | InChIKey=WAAGBMYUYFBZIW-RXMQYKEDSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.