* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-[1-(Piperidin-4-yl)ethyl]morpholine 2HCl |
CAS: | 436852-25-4 |
English Synonyms: | 4-[1-(PIPERIDIN-4-YL)ETHYL]MORPHOLINE 2HCL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | Cl.Cl.N1CCC(CC1)C(C)N1CCOCC1 |
InChi: | InChI=1S/C11H22N2O.2ClH/c1-10(11-2-4-12-5-3-11)13-6-8-14-9-7-13;;/h10-12H,2-9H2,1H3;2*1H |
InChiKey: | InChIKey=PIGXRVSYYHCFLU-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.