* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(4-Azidobutyl)-1H-isoindole-1,3(2H)-dione |
CAS: | 66917-06-4 |
English Synonyms: | 2-(4-AZIDOBUTYL)-1H-ISOINDOLE-1,3(2H)-DIONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N(=[N+]=[N-])CCCCN1C(C2=CC=CC=C2C1=O)=O |
InChi: | InChI=1S/C12H12N4O2/c13-15-14-7-3-4-8-16-11(17)9-5-1-2-6-10(9)12(16)18/h1-2,5-6H,3-4,7-8H2 |
InChiKey: | InChIKey=ORKCIOAZJQNDJI-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.