* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-Methyl-[1,1'-biphenyl]-3-ethanamine |
CAS: | 1895653-59-4 |
English Synonyms: | N-METHYL-[1,1'-BIPHENYL]-3-ETHANAMINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CNCCC=1C=C(C=CC1)C1=CC=CC=C1 |
InChi: | InChI=1S/C15H17N/c1-16-11-10-13-6-5-9-15(12-13)14-7-3-2-4-8-14/h2-9,12,16H,10-11H2,1H3 |
InChiKey: | InChIKey=RFLVSFYXKLFKLW-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.