* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-Methyl-[1,1'-biphenyl]-4-ethanamine |
CAS: | 669015-06-9 |
English Synonyms: | N-METHYL-[1,1'-BIPHENYL]-4-ETHANAMINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CNCCC1=CC=C(C=C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C15H17N/c1-16-12-11-13-7-9-15(10-8-13)14-5-3-2-4-6-14/h2-10,16H,11-12H2,1H3 |
InChiKey: | InChIKey=VLKFAIHXYCUNJA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.