* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-[1,4-Dihydro-6-(2-pyridinyl)-1,2,4,5-tetrazin-3-yl]-3-pyridinamine |
CAS: | 1055983-13-5 |
English Synonyms: | 6-[1,4-DIHYDRO-6-(2-PYRIDINYL)-1,2,4,5-TETRAZIN-3-YL]-3-PYRIDINAMINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N1=C(C=CC=C1)C1=NNC(=NN1)C1=CC=C(C=N1)N |
InChi: | InChI=1S/C12H11N7/c13-8-4-5-10(15-7-8)12-18-16-11(17-19-12)9-3-1-2-6-14-9/h1-7H,13H2,(H,16,17)(H,18,19) |
InChiKey: | InChIKey=QFHAGORNLISARE-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.