* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-chloro-4,6-di(biphenyl-3-yl)-1,3,5-triazine |
CAS: | 1205748-61-3 |
English Synonyms: | 2-CHLORO-4,6-DI(BIPHENYL-3-YL)-1,3,5-TRIAZINE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC1=NC(=NC(=N1)C=1C=C(C=CC1)C1=CC=CC=C1)C=1C=C(C=CC1)C1=CC=CC=C1 |
InChi: | InChI=1S/C27H18ClN3/c28-27-30-25(23-15-7-13-21(17-23)19-9-3-1-4-10-19)29-26(31-27)24-16-8-14-22(18-24)20-11-5-2-6-12-20/h1-18H |
InChiKey: | InChIKey=SVNMSEVGOAHNKQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.