* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (2S,3S,5R)-3-methyl-3-((1-methyl-1H-1,2,3-triazol-3-ium-3-yl)methyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide |
| CAS: | 1001404-83-6 |
| English Synonyms: | (2S,3S,5R)-3-METHYL-3-((1-METHYL-1H-1,2,3-TRIAZOL-3-IUM-3-YL)METHYL)-7-OXO-4-THIA-1-AZABICYCLO[3.2.0]HEPTANE-2-CARBOXYLATE 4,4-DIOXIDE |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | C[C@@]1([C@@H](N2C(C[C@H]2S1(=O)=O)=O)C(=O)[O-])C[N+]1=NN(C=C1)C |
| InChi: | InChI=1S/C11H14N4O5S/c1-11(6-14-4-3-13(2)12-14)9(10(17)18)15-7(16)5-8(15)21(11,19)20/h3-4,8-9H,5-6H2,1-2H3/t8-,9+,11+/m1/s1 |
| InChiKey: | InChIKey=HFZITXBUTWITPT-YWVKMMECSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.