* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LTBB002963 |
| English Synonyms: | LABOTEST-BB LTBB002963 ; 1,2,3,4-TETRACHLOROBUTANE |
| MDL Number.: | MFCD00000945 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | ClCC(Cl)C(Cl)CCl |
| InChi: | InChI=1S/C4H6Cl4/c5-1-3(7)4(8)2-6/h3-4H,1-2H2 |
| InChiKey: | InChIKey=IXZVKECRTHXEEW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.