* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RHODANILE BLUE |
| English Synonyms: | RHODANILE BLUE |
| MDL Number.: | MFCD00011937 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CCN(CC)c1ccc2c(c1)oc-3cc(=[N+](CC)CC)ccc3c2c4ccccc4C(=O)/N=C/5\CC6=C(c7c5cccc7)Nc8ccc(cc8O6)N(CC)CC.[Cl-] |
| InChi: | InChI=1S/C48H49N5O3.ClH/c1-7-51(8-2)31-21-24-38-42(27-31)55-43-28-32(52(9-3)10-4)22-25-39(43)46(38)35-18-14-16-20-37(35)48(54)50-41-30-45-47(36-19-15-13-17-34(36)41)49-40-26-23-33(29-44(40)56-45)53(11-5)12-6;/h13-29H,7-12,30H2,1-6H3;1H/b50-41+; |
| InChiKey: | InChIKey=GBYXMWRXCOWOPW-HAIIBULWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.