* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | LABOTEST-BB LT00244776 |
| English Synonyms: | LABOTEST-BB LT00244776 |
| MDL Number.: | MFCD00016914 |
| H bond acceptor: | 15 |
| H bond donor: | 8 |
| Smile: | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)Oc3cc(c(c(c3)OC)C(=O)/C=C/c4ccc(c(c4)O)OC)O)O)O)O)O)O)O |
| InChi: | InChI=1S/C29H36O15/c1-12-22(33)24(35)26(37)28(42-12)41-11-20-23(34)25(36)27(38)29(44-20)43-14-9-17(32)21(19(10-14)40-3)15(30)6-4-13-5-7-18(39-2)16(31)8-13/h4-10,12,20,22-29,31-38H,11H2,1-3H3/b6-4+ |
| InChiKey: | InChIKey=FDHNLHLOJLLXDH-GQCTYLIASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.