* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(3-CHLOROPHENYL)-4H-3,1-BENZOXAZIN-4-ONE |
CAS: | 35067-68-6 |
English Synonyms: | 2-(3-CHLOROPHENYL)-BENZO[D][1,3]OXAZIN-4-ONE ; 2-(3-CHLOROPHENYL)-4H-3,1-BENZOXAZIN-4-ONE |
MDL Number.: | MFCD00024115 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)c(=O)oc(n2)c3cccc(c3)Cl |
InChi: | InChI=1S/C14H8ClNO2/c15-10-5-3-4-9(8-10)13-16-12-7-2-1-6-11(12)14(17)18-13/h1-8H |
InChiKey: | InChIKey=NJISSPNMTCZNHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.