* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-ETHYLADENINE |
CAS: | 2715-68-6 |
English Synonyms: | 9-ETHYL-9H-PURIN-6-AMINE ; 9-ETHYLADENINE |
MDL Number.: | MFCD00037989 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCn1cnc2c1ncnc2N |
InChi: | InChI=1S/C7H9N5/c1-2-12-4-11-5-6(8)9-3-10-7(5)12/h3-4H,2H2,1H3,(H2,8,9,10) |
InChiKey: | InChIKey=MUIPLRMGAXZWSQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.