* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-UNDECANOL |
| CAS: | 6929-08-4 |
| English Synonyms: | 3-UNDECANOL ; UNDECANOL-3 ; UNDECAN-3-OL |
| MDL Number.: | MFCD00046730 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCCCCCCCC(CC)O |
| InChi: | InChI=1S/C11H24O/c1-3-5-6-7-8-9-10-11(12)4-2/h11-12H,3-10H2,1-2H3 |
| InChiKey: | InChIKey=HCARCYFXWDRVBZ-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.