* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOPROPYLUREA |
CAS: | 691-60-1 |
English Synonyms: | ISOPROPYLUREA ; (PROPAN-2-YL)UREA |
MDL Number.: | MFCD00047875 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(C)NC(=O)N |
InChi: | InChI=1S/C4H10N2O/c1-3(2)6-4(5)7/h3H,1-2H3,(H3,5,6,7) |
InChiKey: | InChIKey=LZMATGARSSLFMQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.