* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUININE CITRATE |
CAS: | 5936-12-9 |
English Synonyms: | QUININE CITRATE |
MDL Number.: | MFCD00050911 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | COc1ccc2c(c1)c(ccn2)[C@H]([C@@H]3C[C@@H]4CCN3C[C@@H]4C=C)O.C(C(=O)O)C(CC(=O)O)(C(=O)O)O |
InChi: | InChI=1S/C20H24N2O2.C6H8O7/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/t13-,14-,19-,20+;/m0./s1 |
InChiKey: | InChIKey=UTYDQRYLTPTQGW-DSXUQNDKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.