* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 6-ETHOXY-1H-INDOLE |
CAS: | 37865-86-4 |
English Synonyms: | 1H-INDOLE, 6-ETHOXY- ; 6-ETHOXYINDOLE ; 6-ETHOXY-1H-INDOLE |
MDL Number.: | MFCD00051498 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCOc1ccc2cc[nH]c2c1 |
InChi: | InChI=1S/C10H11NO/c1-2-12-9-4-3-8-5-6-11-10(8)7-9/h3-7,11H,2H2,1H3 |
InChiKey: | InChIKey=RPMWEGXHQSEPPH-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.