* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IMEXON |
CAS: | 59643-91-3 |
English Synonyms: | IMEXON ; 4-IMINO-1,3-DIAZABICYCLO-[3.1.0]HEXAN-2-ONE |
MDL Number.: | MFCD00056850 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C1C2N1C(=O)NC2=N |
InChi: | InChI=1S/C4H5N3O/c5-3-2-1-7(2)4(8)6-3/h2H,1H2,(H2,5,6,8) |
InChiKey: | InChIKey=BIXBBIPTYBJTRY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.