* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-SER-GLU-OH |
CAS: | 6403-16-3 |
English Synonyms: | SER-GLU ; H-SER-GLU-OH |
MDL Number.: | MFCD00063352 |
H bond acceptor: | 8 |
H bond donor: | 5 |
Smile: | C(CC(=O)O)[C@@H](C(=O)O)NC(=O)[C@H](CO)N |
InChi: | InChI=1S/C8H14N2O6/c9-4(3-11)7(14)10-5(8(15)16)1-2-6(12)13/h4-5,11H,1-3,9H2,(H,10,14)(H,12,13)(H,15,16)/t4-,5-/m0/s1 |
InChiKey: | InChIKey=LAFKUZYWNCHOHT-WHFBIAKZSA-N |
Property |
|
Safety information |
|
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.