* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-THR-TYR-SER-OH |
CAS: | 81161-89-9 |
English Synonyms: | H-THR-TYR-SER-OH |
MDL Number.: | MFCD00063358 |
H bond acceptor: | 10 |
H bond donor: | 7 |
Smile: | C[C@H]([C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)N[C@@H](CO)C(=O)O)N)O |
InChi: | InChI=1S/C16H23N3O7/c1-8(21)13(17)15(24)18-11(6-9-2-4-10(22)5-3-9)14(23)19-12(7-20)16(25)26/h2-5,8,11-13,20-22H,6-7,17H2,1H3,(H,18,24)(H,19,23)(H,25,26)/t8-,11+,12+,13+/m1/s1 |
InChiKey: | InChIKey=CYCGARJWIQWPQM-YJRXYDGGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.