* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-ALA-D-ALA-L-ALA |
CAS: | 5874-86-2 |
English Synonyms: | L-ALA-D-ALA-L-ALA ; H-ALA-D-ALA-ALA-OH ; H-ALA-D-ALA-L-ALA |
MDL Number.: | MFCD00066037 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | C[C@@H](C(=O)N[C@H](C)C(=O)N[C@@H](C)C(=O)O)N |
InChi: | InChI=1S/C9H17N3O4/c1-4(10)7(13)11-5(2)8(14)12-6(3)9(15)16/h4-6H,10H2,1-3H3,(H,11,13)(H,12,14)(H,15,16)/t4-,5+,6-/m0/s1 |
InChiKey: | InChIKey=BYXHQQCXAJARLQ-JKUQZMGJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.