* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (R)-(-)-IBUPROFEN |
| CAS: | 51146-57-7 |
| English Synonyms: | (R)-(-)-IBUPROFEN ; (R)-IBUPROFEN |
| MDL Number.: | MFCD00069290 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)O |
| InChi: | InChI=1S/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)/t10-/m1/s1 |
| InChiKey: | InChIKey=HEFNNWSXXWATRW-SNVBAGLBSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.