* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-SERINE-UL-14C |
| CAS: | 83245-14-1 |
| English Synonyms: | L-SERINE-UL-14C ; SERINE, L-[14C(U)] |
| MDL Number.: | MFCD00069584 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | [14CH2]([14C@@H]([14C](=O)O)N)O |
| InChi: | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1/i1+2,2+2,3+2 |
| InChiKey: | InChIKey=MTCFGRXMJLQNBG-TUTWODFJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.