* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISATIDINE |
| CAS: | 15503-86-3 |
| English Synonyms: | ISATIDINE ; RETRORSIN-N-OXIDE |
| MDL Number.: | MFCD00074872 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | C/C=C\1/C[C@@H]([C@@](C(=O)OCC2=CC[N+]3([C@H]2[C@@H](CC3)OC1=O)[O-])(CO)O)C |
| InChi: | InChI=1S/C18H25NO7/c1-3-12-8-11(2)18(23,10-20)17(22)25-9-13-4-6-19(24)7-5-14(15(13)19)26-16(12)21/h3-4,11,14-15,20,23H,5-10H2,1-2H3/b12-3-/t11-,14+,15+,18+,19?/m0/s1 |
| InChiKey: | InChIKey=IDIMIWQPUHURPV-OOFASRIMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.