* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4,15-DIACETYLVERRUCAROL |
| CAS: | 2198-94-9 |
| English Synonyms: | 4,15-DIACETYLVERRUCAROL |
| MDL Number.: | MFCD00078781 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC1=CC2[C@](CC1)([C@]3([C@@H](C[C@H](C34CO4)O2)OC(=O)C)C)COC(=O)C |
| InChi: | InChI=1S/C19H26O6/c1-11-5-6-18(9-22-12(2)20)15(7-11)25-16-8-14(24-13(3)21)17(18,4)19(16)10-23-19/h7,14-16H,5-6,8-10H2,1-4H3/t14-,15?,16-,17-,18-,19?/m1/s1 |
| InChiKey: | InChIKey=CVJVDRZXGYXIET-KXFVLVJSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.