* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL F1 4010 |
| English Synonyms: | RARECHEM AL F1 4010 |
| MDL Number.: | MFCD00102903 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)n2c(nnn2)/C=C/N3CCCCCC3 |
| InChi: | InChI=1S/C15H19N5/c1-2-7-12-19(11-6-1)13-10-15-16-17-18-20(15)14-8-4-3-5-9-14/h3-5,8-10,13H,1-2,6-7,11-12H2/b13-10+ |
| InChiKey: | InChIKey=GNZMIOJVXGCJPP-JLHYYAGUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.