* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHYL-9H-PURIN-6-OL |
CAS: | 875-31-0 ;113336-00-8 |
English Synonyms: | 9H-PURIN-6-OL, 9-METHYL- ; 9-METHYL-9H-PURIN-6-OL |
MDL Number.: | MFCD00127899 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cn1cnc2c1ncnc2O |
InChi: | InChI=1S/C6H6N4O/c1-10-3-9-4-5(10)7-2-8-6(4)11/h2-3H,1H3,(H,7,8,11) |
InChiKey: | InChIKey=PESGUQRDJASXOR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.