* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HYPOXANTHINE, [8-14C] |
CAS: | 23199-34-0 |
English Synonyms: | HYPOXANTHINE, [8-14C] |
MDL Number.: | MFCD00135439 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1[nH]c(=O)c2c(n1)n[14cH][nH]2 |
InChi: | InChI=1S/C5H4N4O/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10)/i1+2 |
InChiKey: | InChIKey=FDGQSTZJBFJUBT-NJFSPNSNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.